C17H17Cl2F6N3O4 — CID 20716529
(2S)-1-[(2S)-2-aminobutanoyl]-5,6-dichloro-N-(2,2,2-trifluoroethyl)-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 20716529) has the molecular formula C17H17Cl2F6N3O4 and a molecular weight of 512.23 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-aminobutanoyl]-5,6-dichloro-N-(2,2,2-trifluoroethyl)-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-1-[(2S)-2-aminobutanoyl]-5,6-dichloro-N-(2,2,2-trifluoroethyl)-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 20716529 |
| Molecular Formula | C17H17Cl2F6N3O4 |
| Molecular Weight | 512.23 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | (2S)-1-[(2S)-2-aminobutanoyl]-5,6-dichloro-N-(2,2,2-trifluoroethyl)-2,3-dihydroindole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](N)C(=O)N1c2cc(Cl)c(Cl)cc2C[C@H]1C(=O)NCC(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16Cl2F3N3O2.C2HF3O2/c1-2-10(21)14(25)23-11-5-9(17)8(16)3-7(11)4-12(23)13(24)22-6-15(18,19)20;3-2(4,5)1(6)7/h3,5,10,12H,2,4,6,21H2,1H3,(H,22,24);(H,6,7)/t10-,12-;/m0./s1 |
| InChIKey | DCCMZPMOWUWFIO-JGAZGGJJSA-N |
| XLogP | 3.30 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |