C23H52O4Si2 — CID 20716716
[9-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylnonyl]-dimethoxy-methylsilane (PubChem CID 20716716) has the molecular formula C23H52O4Si2 and a molecular weight of 448.84 g/mol. Its IUPAC name is [9-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylnonyl]-dimethoxy-methylsilane.
| Compound Name | [9-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylnonyl]-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 20716716 |
| Molecular Formula | C23H52O4Si2 |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | [9-[dimethoxy(methyl)silyl]-2,2,4,4,6,6,8,8-octamethylnonyl]-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(CC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)C[Si](C)(OC)OC)OC |
| InChI | InChI=1S/C23H52O4Si2/c1-20(2,16-22(5,6)18-28(13,24-9)25-10)15-21(3,4)17-23(7,8)19-29(14,26-11)27-12/h15-19H2,1-14H3 |
| InChIKey | YTUUALPVJYKTRS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|