C12H13N3O4 — CID 20716755
5-(1,4-dimethyl-2,5-dioxopyrrol-3-yl)-1,6-dimethylpyrimidine-2,4-dione (PubChem CID 20716755) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-(1,4-dimethyl-2,5-dioxopyrrol-3-yl)-1,6-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-(1,4-dimethyl-2,5-dioxopyrrol-3-yl)-1,6-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20716755 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-(1,4-dimethyl-2,5-dioxopyrrol-3-yl)-1,6-dimethylpyrimidine-2,4-dione |
| SMILES | CC1=C(c2c(C)n(C)c(=O)[nH]c2=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H13N3O4/c1-5-7(11(18)15(4)10(5)17)8-6(2)14(3)12(19)13-9(8)16/h1-4H3,(H,13,16,19) |
| InChIKey | ZHXZNWZWZFUCRJ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|