About 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole
3,4-dimethyl-5-methylidene-3,4-dihydropyrazole (PubChem CID 20716946) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole |
| PubChem CID | 20716946 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole |
| SMILES | C=C1N=NC(C)C1C |
| InChI | InChI=1S/C6H10N2/c1-4-5(2)7-8-6(4)3/h4,6H,2H2,1,3H3 |
| InChIKey | CVRVJXJCGGNPLZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole?
The IUPAC name of 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole (CID 20716946) is 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole.
What is the SMILES notation for 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole?
The canonical SMILES for 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole is C=C1N=NC(C)C1C.
What is the InChIKey of 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole?
The InChIKey is CVRVJXJCGGNPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-4-5(2)7-8-6(4)3/h4,6H,2H2,1,3H3.
What are the key properties of 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole?
3,4-dimethyl-5-methylidene-3,4-dihydropyrazole has a molecular weight of 110.16 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-methylidene-3,4-dihydropyrazole is sourced from PubChem (CID 20716946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).