C6H10N3NaO3S2 — CID 20717125
sodium 2-(1,5-dimethyl-3-sulfido-1,2,4-triazol-4-ium-4-yl)ethanesulfonate (PubChem CID 20717125) has the molecular formula C6H10N3NaO3S2 and a molecular weight of 259.29 g/mol. Its IUPAC name is sodium 2-(1,5-dimethyl-3-sulfido-1,2,4-triazol-4-ium-4-yl)ethanesulfonate.
| Compound Name | sodium 2-(1,5-dimethyl-3-sulfido-1,2,4-triazol-4-ium-4-yl)ethanesulfonate |
|---|---|
| PubChem CID | 20717125 |
| Molecular Formula | C6H10N3NaO3S2 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | sodium 2-(1,5-dimethyl-3-sulfido-1,2,4-triazol-4-ium-4-yl)ethanesulfonate |
| SMILES | Cc1n(C)nc([S-])[n+]1CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H11N3O3S2.Na/c1-5-8(2)7-6(13)9(5)3-4-14(10,11)12;/h3-4H2,1-2H3,(H-,7,10,11,12,13);/q;+1/p-1 |
| InChIKey | RVYGRMGAOKRRIE-UHFFFAOYSA-M |
| XLogP | -4.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|