About 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine (PubChem CID 20718034) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine |
| PubChem CID | 20718034 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine |
| SMILES | CN1CC=C(c2ncccn2)CC1 |
| InChI | InChI=1S/C10H13N3/c1-13-7-3-9(4-8-13)10-11-5-2-6-12-10/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | LAIUHFVRTRLCNE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine?
The IUPAC name of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine (CID 20718034) is 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine.
What is the SMILES notation for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine?
The canonical SMILES for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine is CN1CC=C(c2ncccn2)CC1.
What is the InChIKey of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine?
The InChIKey is LAIUHFVRTRLCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-13-7-3-9(4-8-13)10-11-5-2-6-12-10/h2-3,5-6H,4,7-8H2,1H3.
What are the key properties of 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine?
2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine has a molecular weight of 175.24 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)pyrimidine is sourced from PubChem (CID 20718034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).