About 5-fluoro-2,4-dimethylpyrimidine
5-fluoro-2,4-dimethylpyrimidine (PubChem CID 20718048) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is 5-fluoro-2,4-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2,4-dimethylpyrimidine |
| PubChem CID | 20718048 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | 5-fluoro-2,4-dimethylpyrimidine |
| SMILES | Cc1ncc(F)c(C)n1 |
| InChI | InChI=1S/C6H7FN2/c1-4-6(7)3-8-5(2)9-4/h3H,1-2H3 |
| InChIKey | VWLHFPYDMKSVGD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,4-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4-dimethylpyrimidine?
The IUPAC name of 5-fluoro-2,4-dimethylpyrimidine (CID 20718048) is 5-fluoro-2,4-dimethylpyrimidine.
What is the SMILES notation for 5-fluoro-2,4-dimethylpyrimidine?
The canonical SMILES for 5-fluoro-2,4-dimethylpyrimidine is Cc1ncc(F)c(C)n1.
What is the InChIKey of 5-fluoro-2,4-dimethylpyrimidine?
The InChIKey is VWLHFPYDMKSVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2/c1-4-6(7)3-8-5(2)9-4/h3H,1-2H3.
What are the key properties of 5-fluoro-2,4-dimethylpyrimidine?
5-fluoro-2,4-dimethylpyrimidine has a molecular weight of 126.13 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4-dimethylpyrimidine is sourced from PubChem (CID 20718048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).