About methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+)
methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) (PubChem CID 20718569) has the molecular formula C6H7N2O2W+
and a molecular weight of 322.97 g/mol. Its IUPAC name is methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+).
Molecular Properties
| Compound Name | methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) |
| PubChem CID | 20718569 |
| Molecular Formula | C6H7N2O2W+ |
| Molecular Weight | 322.97 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) |
| SMILES | COC(=O)C1=NN=[C-]C1C.[W+2] |
| InChI | InChI=1S/C6H7N2O2.W/c1-4-3-7-8-5(4)6(9)10-2;/h4H,1-2H3;/q-1;+2 |
| InChIKey | XLPBZFUNVUPMOU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.97 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+)?
The IUPAC name of methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) (CID 20718569) is methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+).
What is the SMILES notation for methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+)?
The canonical SMILES for methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) is COC(=O)C1=NN=[C-]C1C.[W+2].
What is the InChIKey of methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+)?
The InChIKey is XLPBZFUNVUPMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N2O2.W/c1-4-3-7-8-5(4)6(9)10-2;/h4H,1-2H3;/q-1;+2.
What are the key properties of methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+)?
methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) has a molecular weight of 322.97 g/mol, XLogP of 0.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3,4-dihydropyrazol-3-ide-5-carboxylate;tungsten(2+) is sourced from PubChem (CID 20718569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).