C8H8N2 — CID 20718665
1-N,2-N-dimethylcyclohexa-3,4,5-triene-1,2-diimine (PubChem CID 20718665) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 1-N,2-N-dimethylcyclohexa-3,4,5-triene-1,2-diimine.
| Compound Name | 1-N,2-N-dimethylcyclohexa-3,4,5-triene-1,2-diimine |
|---|---|
| PubChem CID | 20718665 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1-N,2-N-dimethylcyclohexa-3,4,5-triene-1,2-diimine |
| SMILES | C/N=C1\C=C=C=C\C1=N/C |
| InChI | InChI=1S/C8H8N2/c1-9-7-5-3-4-6-8(7)10-2/h5-6H,1-2H3/b9-7+,10-8+ |
| InChIKey | XGQKZSLPSNAUIV-FIFLTTCUSA-N |
| XLogP | 1.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|