C20H19NO4S — CID 20718981
2-(6-methoxy-1-benzofuran-2-yl)-1,3-dimethyl-6-methylsulfonylindole (PubChem CID 20718981) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-2-yl)-1,3-dimethyl-6-methylsulfonylindole.
| Compound Name | 2-(6-methoxy-1-benzofuran-2-yl)-1,3-dimethyl-6-methylsulfonylindole |
|---|---|
| PubChem CID | 20718981 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-2-yl)-1,3-dimethyl-6-methylsulfonylindole |
| SMILES | COc1ccc2cc(-c3c(C)c4ccc(S(C)(=O)=O)cc4n3C)oc2c1 |
| InChI | InChI=1S/C20H19NO4S/c1-12-16-8-7-15(26(4,22)23)11-17(16)21(2)20(12)19-9-13-5-6-14(24-3)10-18(13)25-19/h5-11H,1-4H3 |
| InChIKey | QJUKWAAPGUHXDX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|