C12H3F5N2O3 — CID 20719082
3-(2,5-difluoro-4-isocyanophenyl)-6-(trifluoromethyl)-1,3-oxazine-2,4-dione (PubChem CID 20719082) has the molecular formula C12H3F5N2O3 and a molecular weight of 318.16 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-isocyanophenyl)-6-(trifluoromethyl)-1,3-oxazine-2,4-dione.
| Compound Name | 3-(2,5-difluoro-4-isocyanophenyl)-6-(trifluoromethyl)-1,3-oxazine-2,4-dione |
|---|---|
| PubChem CID | 20719082 |
| Molecular Formula | C12H3F5N2O3 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-(2,5-difluoro-4-isocyanophenyl)-6-(trifluoromethyl)-1,3-oxazine-2,4-dione |
| SMILES | [C-]#[N+]c1cc(F)c(-n2c(=O)cc(C(F)(F)F)oc2=O)cc1F |
| InChI | InChI=1S/C12H3F5N2O3/c1-18-7-2-6(14)8(3-5(7)13)19-10(20)4-9(12(15,16)17)22-11(19)21/h2-4H |
| InChIKey | VNJZXMQCNOBARC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|