About 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione
3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 20719083) has the molecular formula C15H13F3N2O3
and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 20719083 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(C)cc1C |
| InChI | InChI=1S/C15H13F3N2O3/c1-7-4-8(2)11(5-10(7)9(3)21)20-13(22)6-12(15(16,17)18)19-14(20)23/h4-6H,1-3H3,(H,19,23) |
| InChIKey | SEBIOOPBQKJIEZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CID 20719083) is 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione is CC(=O)c1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)c(C)cc1C.
What is the InChIKey of 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
The InChIKey is SEBIOOPBQKJIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2O3/c1-7-4-8(2)11(5-10(7)9(3)21)20-13(22)6-12(15(16,17)18)19-14(20)23/h4-6H,1-3H3,(H,19,23).
What are the key properties of 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione?
3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione has a molecular weight of 326.27 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-acetyl-2,4-dimethylphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 20719083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).