C16H17FN2O4 — CID 20719092
N-(7-fluoro-3-methylidene-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-3,3-dihydroxybutanamide (PubChem CID 20719092) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is N-(7-fluoro-3-methylidene-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-3,3-dihydroxybutanamide.
| Compound Name | N-(7-fluoro-3-methylidene-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-3,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 20719092 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(7-fluoro-3-methylidene-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-3,3-dihydroxybutanamide |
| SMILES | C#CCN1C(=C)COc2cc(F)c(NC(=O)CC(C)(O)O)cc21 |
| InChI | InChI=1S/C16H17FN2O4/c1-4-5-19-10(2)9-23-14-6-11(17)12(7-13(14)19)18-15(20)8-16(3,21)22/h1,6-7,21-22H,2,5,8-9H2,3H3,(H,18,20) |
| InChIKey | ZHKXBMPEWQPRSY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|