C25H40N4O2 — CID 20719473
2-hexyldecyl 6-isocyano-2,5-dimethyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20719473) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-hexyldecyl 6-isocyano-2,5-dimethyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | 2-hexyldecyl 6-isocyano-2,5-dimethyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20719473 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 2-hexyldecyl 6-isocyano-2,5-dimethyl-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OCC(CCCCCC)CCCCCCCC)c2nc(C)[nH]n2c1C |
| InChI | InChI=1S/C25H40N4O2/c1-6-8-10-12-13-15-17-21(16-14-11-9-7-2)18-31-25(30)22-23(26-5)19(3)29-24(22)27-20(4)28-29/h21H,6-18H2,1-4H3,(H,27,28) |
| InChIKey | QNHYPYWLOSUKTJ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|