C17H16N4O2 — CID 20719551
ethyl 6-isocyano-5-methyl-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20719551) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is ethyl 6-isocyano-5-methyl-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | ethyl 6-isocyano-5-methyl-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20719551 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 6-isocyano-5-methyl-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OCC)c2nc(-c3ccc(C)cc3)[nH]n2c1C |
| InChI | InChI=1S/C17H16N4O2/c1-5-23-17(22)13-14(18-4)11(3)21-16(13)19-15(20-21)12-8-6-10(2)7-9-12/h6-9H,5H2,1-3H3,(H,19,20) |
| InChIKey | CDTNYMMUHCVNHS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|