About 10-aminoanthracen-9-ol
10-aminoanthracen-9-ol (PubChem CID 20719613) has the molecular formula C14H11NO
and a molecular weight of 209.25 g/mol. Its IUPAC name is 10-aminoanthracen-9-ol.
Molecular Properties
| Compound Name | 10-aminoanthracen-9-ol |
| PubChem CID | 20719613 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 10-aminoanthracen-9-ol |
| SMILES | Nc1c2ccccc2c(O)c2ccccc12 |
| InChI | InChI=1S/C14H11NO/c15-13-9-5-1-3-7-11(9)14(16)12-8-4-2-6-10(12)13/h1-8,16H,15H2 |
| InChIKey | OOJPSZYCENKVLJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-aminoanthracen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-aminoanthracen-9-ol?
The IUPAC name of 10-aminoanthracen-9-ol (CID 20719613) is 10-aminoanthracen-9-ol.
What is the SMILES notation for 10-aminoanthracen-9-ol?
The canonical SMILES for 10-aminoanthracen-9-ol is Nc1c2ccccc2c(O)c2ccccc12.
What is the InChIKey of 10-aminoanthracen-9-ol?
The InChIKey is OOJPSZYCENKVLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO/c15-13-9-5-1-3-7-11(9)14(16)12-8-4-2-6-10(12)13/h1-8,16H,15H2.
What are the key properties of 10-aminoanthracen-9-ol?
10-aminoanthracen-9-ol has a molecular weight of 209.25 g/mol, XLogP of 3.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-aminoanthracen-9-ol is sourced from PubChem (CID 20719613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).