C14H20O3 — CID 20719937
(2E,4E)-5-[(5S)-2,5-dimethyl-1,3-dioxaspiro[3.5]nonan-5-yl]penta-2,4-dienal (PubChem CID 20719937) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2E,4E)-5-[(5S)-2,5-dimethyl-1,3-dioxaspiro[3.5]nonan-5-yl]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(5S)-2,5-dimethyl-1,3-dioxaspiro[3.5]nonan-5-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 20719937 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2E,4E)-5-[(5S)-2,5-dimethyl-1,3-dioxaspiro[3.5]nonan-5-yl]penta-2,4-dienal |
| SMILES | CC1OC2(CCCC[C@@]2(C)/C=C/C=C/C=O)O1 |
| InChI | InChI=1S/C14H20O3/c1-12-16-14(17-12)10-6-5-9-13(14,2)8-4-3-7-11-15/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3/b7-3+,8-4+/t12?,13-,14?/m1/s1 |
| InChIKey | WBLNOVBXOJQWKR-QUEUTFIBSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|