About 3-ethyl-1,2,4-trimethylpyrrolidine
3-ethyl-1,2,4-trimethylpyrrolidine (PubChem CID 20720048) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 3-ethyl-1,2,4-trimethylpyrrolidine.
Molecular Properties
| Compound Name | 3-ethyl-1,2,4-trimethylpyrrolidine |
| PubChem CID | 20720048 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 3-ethyl-1,2,4-trimethylpyrrolidine |
| SMILES | CCC1C(C)CN(C)C1C |
| InChI | InChI=1S/C9H19N/c1-5-9-7(2)6-10(4)8(9)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | OJPFFURUOVAYDY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,2,4-trimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2,4-trimethylpyrrolidine?
The IUPAC name of 3-ethyl-1,2,4-trimethylpyrrolidine (CID 20720048) is 3-ethyl-1,2,4-trimethylpyrrolidine.
What is the SMILES notation for 3-ethyl-1,2,4-trimethylpyrrolidine?
The canonical SMILES for 3-ethyl-1,2,4-trimethylpyrrolidine is CCC1C(C)CN(C)C1C.
What is the InChIKey of 3-ethyl-1,2,4-trimethylpyrrolidine?
The InChIKey is OJPFFURUOVAYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-5-9-7(2)6-10(4)8(9)3/h7-9H,5-6H2,1-4H3.
What are the key properties of 3-ethyl-1,2,4-trimethylpyrrolidine?
3-ethyl-1,2,4-trimethylpyrrolidine has a molecular weight of 141.26 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2,4-trimethylpyrrolidine is sourced from PubChem (CID 20720048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).