C17H21N7O2 — CID 20720165
6,7-dimethyl-5-[1-(2H-tetrazol-5-ylmethyl)piperidin-2-yl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 20720165) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 6,7-dimethyl-5-[1-(2H-tetrazol-5-ylmethyl)piperidin-2-yl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-dimethyl-5-[1-(2H-tetrazol-5-ylmethyl)piperidin-2-yl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 20720165 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 6,7-dimethyl-5-[1-(2H-tetrazol-5-ylmethyl)piperidin-2-yl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2c(C2CCCCN2Cc2nn[nH]n2)c1C |
| InChI | InChI=1S/C17H21N7O2/c1-9-7-11-15(19-17(26)16(25)18-11)14(10(9)2)12-5-3-4-6-24(12)8-13-20-22-23-21-13/h7,12H,3-6,8H2,1-2H3,(H,18,25)(H,19,26)(H,20,21,22,23) |
| InChIKey | XBDBRHQJNUYFIQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|