C12H12N6O2 — CID 20720168
6,7-dimethyl-5-(2H-tetrazol-5-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 20720168) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 6,7-dimethyl-5-(2H-tetrazol-5-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-dimethyl-5-(2H-tetrazol-5-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 20720168 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 6,7-dimethyl-5-(2H-tetrazol-5-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | Cc1cc2[nH]c(=O)c(=O)[nH]c2c(Cc2nn[nH]n2)c1C |
| InChI | InChI=1S/C12H12N6O2/c1-5-3-8-10(14-12(20)11(19)13-8)7(6(5)2)4-9-15-17-18-16-9/h3H,4H2,1-2H3,(H,13,19)(H,14,20)(H,15,16,17,18) |
| InChIKey | ZYXNUDDQMHCZPF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|