C24H29N3O2S — CID 20720195
(2R,4S)-2-[4-[7-(4-ethylpiperazin-1-yl)thieno[2,3-c]pyridin-5-yl]phenyl]oxan-4-ol (PubChem CID 20720195) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is (2R,4S)-2-[4-[7-(4-ethylpiperazin-1-yl)thieno[2,3-c]pyridin-5-yl]phenyl]oxan-4-ol.
| Compound Name | (2R,4S)-2-[4-[7-(4-ethylpiperazin-1-yl)thieno[2,3-c]pyridin-5-yl]phenyl]oxan-4-ol |
|---|---|
| PubChem CID | 20720195 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2R,4S)-2-[4-[7-(4-ethylpiperazin-1-yl)thieno[2,3-c]pyridin-5-yl]phenyl]oxan-4-ol |
| SMILES | CCN1CCN(c2nc(-c3ccc([C@H]4C[C@@H](O)CCO4)cc3)cc3ccsc23)CC1 |
| InChI | InChI=1S/C24H29N3O2S/c1-2-26-9-11-27(12-10-26)24-23-19(8-14-30-23)15-21(25-24)17-3-5-18(6-4-17)22-16-20(28)7-13-29-22/h3-6,8,14-15,20,22,28H,2,7,9-13,16H2,1H3/t20-,22+/m0/s1 |
| InChIKey | NUUAPGIGIVNWEI-RBBKRZOGSA-N |
| XLogP | 4.32 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |