C11H13NO — CID 20720242
3-ethyl-4-methyl-2,7-dihydrocyclopenta[c]pyridin-1-one (PubChem CID 20720242) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-ethyl-4-methyl-2,7-dihydrocyclopenta[c]pyridin-1-one.
| Compound Name | 3-ethyl-4-methyl-2,7-dihydrocyclopenta[c]pyridin-1-one |
|---|---|
| PubChem CID | 20720242 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-ethyl-4-methyl-2,7-dihydrocyclopenta[c]pyridin-1-one |
| SMILES | CCc1[nH]c(=O)c2c(c1C)C=CC2 |
| InChI | InChI=1S/C11H13NO/c1-3-10-7(2)8-5-4-6-9(8)11(13)12-10/h4-5H,3,6H2,1-2H3,(H,12,13) |
| InChIKey | RUPSWBXFJYHLIZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |