About N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline
N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline (PubChem CID 20720817) has the molecular formula C23H33NO2S
and a molecular weight of 387.59 g/mol. Its IUPAC name is N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline.
Molecular Properties
| Compound Name | N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline |
| PubChem CID | 20720817 |
| Molecular Formula | C23H33NO2S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline |
| SMILES | CCCCN(C)c1cc(C)c(S(=O)c2ccc(OC)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C23H33NO2S/c1-8-9-12-24(6)19-13-17(4)23(18(5)14-19)27(25)20-10-11-22(26-7)21(15-20)16(2)3/h10-11,13-16H,8-9,12H2,1-7H3 |
| InChIKey | KADJDUOQOLMAMP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline?
The IUPAC name of N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline (CID 20720817) is N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline.
What is the SMILES notation for N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline?
The canonical SMILES for N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline is CCCCN(C)c1cc(C)c(S(=O)c2ccc(OC)c(C(C)C)c2)c(C)c1.
What is the InChIKey of N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline?
The InChIKey is KADJDUOQOLMAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO2S/c1-8-9-12-24(6)19-13-17(4)23(18(5)14-19)27(25)20-10-11-22(26-7)21(15-20)16(2)3/h10-11,13-16H,8-9,12H2,1-7H3.
What are the key properties of N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline?
N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline has a molecular weight of 387.59 g/mol, XLogP of 5.84, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-(4-methoxy-3-propan-2-ylphenyl)sulfinyl-N,3,5-trimethylaniline is sourced from PubChem (CID 20720817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).