About 1,6-dimethylpyrazolo[3,4-d]pyrimidine
1,6-dimethylpyrazolo[3,4-d]pyrimidine (PubChem CID 20720866) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 1,6-dimethylpyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1,6-dimethylpyrazolo[3,4-d]pyrimidine |
| PubChem CID | 20720866 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1,6-dimethylpyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1ncc2cnn(C)c2n1 |
| InChI | InChI=1S/C7H8N4/c1-5-8-3-6-4-9-11(2)7(6)10-5/h3-4H,1-2H3 |
| InChIKey | DFMFWXDQDRPJPV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-dimethylpyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethylpyrazolo[3,4-d]pyrimidine?
The IUPAC name of 1,6-dimethylpyrazolo[3,4-d]pyrimidine (CID 20720866) is 1,6-dimethylpyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 1,6-dimethylpyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 1,6-dimethylpyrazolo[3,4-d]pyrimidine is Cc1ncc2cnn(C)c2n1.
What is the InChIKey of 1,6-dimethylpyrazolo[3,4-d]pyrimidine?
The InChIKey is DFMFWXDQDRPJPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-8-3-6-4-9-11(2)7(6)10-5/h3-4H,1-2H3.
What are the key properties of 1,6-dimethylpyrazolo[3,4-d]pyrimidine?
1,6-dimethylpyrazolo[3,4-d]pyrimidine has a molecular weight of 148.17 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethylpyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 20720866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).