About 5-(4-ethylphenyl)-1,3-thiazole
5-(4-ethylphenyl)-1,3-thiazole (PubChem CID 20721145) has the molecular formula C11H11NS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(4-ethylphenyl)-1,3-thiazole |
| PubChem CID | 20721145 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 5-(4-ethylphenyl)-1,3-thiazole |
| SMILES | CCc1ccc(-c2cncs2)cc1 |
| InChI | InChI=1S/C11H11NS/c1-2-9-3-5-10(6-4-9)11-7-12-8-13-11/h3-8H,2H2,1H3 |
| InChIKey | BDPGETLZDDXJDK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-ethylphenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethylphenyl)-1,3-thiazole?
The IUPAC name of 5-(4-ethylphenyl)-1,3-thiazole (CID 20721145) is 5-(4-ethylphenyl)-1,3-thiazole.
What is the SMILES notation for 5-(4-ethylphenyl)-1,3-thiazole?
The canonical SMILES for 5-(4-ethylphenyl)-1,3-thiazole is CCc1ccc(-c2cncs2)cc1.
What is the InChIKey of 5-(4-ethylphenyl)-1,3-thiazole?
The InChIKey is BDPGETLZDDXJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS/c1-2-9-3-5-10(6-4-9)11-7-12-8-13-11/h3-8H,2H2,1H3.
What are the key properties of 5-(4-ethylphenyl)-1,3-thiazole?
5-(4-ethylphenyl)-1,3-thiazole has a molecular weight of 189.28 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethylphenyl)-1,3-thiazole is sourced from PubChem (CID 20721145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).