About actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol
actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol (PubChem CID 20721274) has the molecular formula C18H14Ac2O4
and a molecular weight of 748.31 g/mol. Its IUPAC name is actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol.
Molecular Properties
| Compound Name | actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol |
| PubChem CID | 20721274 |
| Molecular Formula | C18H14Ac2O4 |
| Molecular Weight | 748.31 g/mol |
| Exact Mass | 748.14 |
| IUPAC Name | actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol |
| SMILES | COc1cc2c(c3ccc(O)cc13)OCc1cc(O)ccc1-2.[Ac].[Ac] |
| InChI | InChI=1S/C18H14O4.2Ac/c1-21-17-8-16-13-4-2-11(19)6-10(13)9-22-18(16)14-5-3-12(20)7-15(14)17;;/h2-8,19-20H,9H2,1H3;; |
| InChIKey | XVVHWHCBDWCZOP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 748.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol?
The IUPAC name of actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol (CID 20721274) is actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol.
What is the SMILES notation for actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol?
The canonical SMILES for actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol is COc1cc2c(c3ccc(O)cc13)OCc1cc(O)ccc1-2.[Ac].[Ac].
What is the InChIKey of actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol?
The InChIKey is XVVHWHCBDWCZOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4.2Ac/c1-21-17-8-16-13-4-2-11(19)6-10(13)9-22-18(16)14-5-3-12(20)7-15(14)17;;/h2-8,19-20H,9H2,1H3;;.
What are the key properties of actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol?
actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol has a molecular weight of 748.31 g/mol, XLogP of 3.82, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;12-methoxy-6H-naphtho[1,2-c]isochromene-2,8-diol is sourced from PubChem (CID 20721274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).