About 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one
2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one (PubChem CID 20721318) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one |
| PubChem CID | 20721318 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one |
| SMILES | CC1=NC2=C(CCCC2)C(=O)C1 |
| InChI | InChI=1S/C10H13NO/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h2-6H2,1H3 |
| InChIKey | YCVRXSAFXBUPRO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The IUPAC name of 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one (CID 20721318) is 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one.
What is the SMILES notation for 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The canonical SMILES for 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one is CC1=NC2=C(CCCC2)C(=O)C1.
What is the InChIKey of 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
The InChIKey is YCVRXSAFXBUPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h2-6H2,1H3.
What are the key properties of 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one?
2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one has a molecular weight of 163.22 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6,7,8-tetrahydro-3H-quinolin-4-one is sourced from PubChem (CID 20721318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).