About 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one
2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one (PubChem CID 20721320) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one.
Molecular Properties
| Compound Name | 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one |
| PubChem CID | 20721320 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one |
| SMILES | CC1=NC2=C(CCC2)C(=O)C1 |
| InChI | InChI=1S/C9H11NO/c1-6-5-9(11)7-3-2-4-8(7)10-6/h2-5H2,1H3 |
| InChIKey | YTRKHYJBPTYMEH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one?
The IUPAC name of 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one (CID 20721320) is 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one.
What is the SMILES notation for 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one?
The canonical SMILES for 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one is CC1=NC2=C(CCC2)C(=O)C1.
What is the InChIKey of 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one?
The InChIKey is YTRKHYJBPTYMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-6-5-9(11)7-3-2-4-8(7)10-6/h2-5H2,1H3.
What are the key properties of 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one?
2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one has a molecular weight of 149.19 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,5,6,7-tetrahydrocyclopenta[b]pyridin-4-one is sourced from PubChem (CID 20721320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).