C14H10N2 — CID 20721702
1-N,1-N'-dimethyldodeca-1,2,3,4,5,6,7,8,9,10,11-undecaene-1,1-diamine (PubChem CID 20721702) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-N,1-N'-dimethyldodeca-1,2,3,4,5,6,7,8,9,10,11-undecaene-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyldodeca-1,2,3,4,5,6,7,8,9,10,11-undecaene-1,1-diamine |
|---|---|
| PubChem CID | 20721702 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-N,1-N'-dimethyldodeca-1,2,3,4,5,6,7,8,9,10,11-undecaene-1,1-diamine |
| SMILES | C=C=C=C=C=C=C=C=C=C=C=C(NC)NC |
| InChI | InChI=1S/C14H10N2/c1-4-5-6-7-8-9-10-11-12-13-14(15-2)16-3/h15-16H,1H2,2-3H3 |
| InChIKey | SNOMKGCDALZNNH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |