C30H32N4O2 — CID 20721759
(4-phenylphenyl) 4-[(4,6-dibutyl-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 20721759) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is (4-phenylphenyl) 4-[(4,6-dibutyl-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | (4-phenylphenyl) 4-[(4,6-dibutyl-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 20721759 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (4-phenylphenyl) 4-[(4,6-dibutyl-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | CCCCc1nc(CCCC)nc(Nc2ccc(C(=O)Oc3ccc(-c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C30H32N4O2/c1-3-5-12-27-32-28(13-6-4-2)34-30(33-27)31-25-18-14-24(15-19-25)29(35)36-26-20-16-23(17-21-26)22-10-8-7-9-11-22/h7-11,14-21H,3-6,12-13H2,1-2H3,(H,31,32,33,34) |
| InChIKey | GCHDDIZPTHGCQF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|