C8H13N4+ — CID 20721793
3-(2-isocyanoethyl)-1,4,5-trimethyl-1,2,4-triazol-4-ium (PubChem CID 20721793) has the molecular formula C8H13N4+ and a molecular weight of 165.22 g/mol. Its IUPAC name is 3-(2-isocyanoethyl)-1,4,5-trimethyl-1,2,4-triazol-4-ium.
| Compound Name | 3-(2-isocyanoethyl)-1,4,5-trimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 20721793 |
| Molecular Formula | C8H13N4+ |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | 3-(2-isocyanoethyl)-1,4,5-trimethyl-1,2,4-triazol-4-ium |
| SMILES | [C-]#[N+]CCc1nn(C)c(C)[n+]1C |
| InChI | InChI=1S/C8H13N4/c1-7-11(3)8(5-6-9-2)10-12(7)4/h5-6H2,1,3-4H3/q+1 |
| InChIKey | AHMDOILUCXBWSB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 26.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|