About 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide
3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide (PubChem CID 20721795) has the molecular formula C11H12ClN2OS+
and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide.
Molecular Properties
| Compound Name | 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide |
| PubChem CID | 20721795 |
| Molecular Formula | C11H12ClN2OS+ |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide |
| SMILES | Cc1sc2cc(Cl)ccc2[n+]1CCC(N)=O |
| InChI | InChI=1S/C11H11ClN2OS/c1-7-14(5-4-11(13)15)9-3-2-8(12)6-10(9)16-7/h2-3,6H,4-5H2,1H3,(H-,13,15)/p+1 |
| InChIKey | UUZJZZLDWCNHMF-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 46.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide?
The IUPAC name of 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide (CID 20721795) is 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide.
What is the SMILES notation for 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide?
The canonical SMILES for 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide is Cc1sc2cc(Cl)ccc2[n+]1CCC(N)=O.
What is the InChIKey of 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide?
The InChIKey is UUZJZZLDWCNHMF-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H11ClN2OS/c1-7-14(5-4-11(13)15)9-3-2-8(12)6-10(9)16-7/h2-3,6H,4-5H2,1H3,(H-,13,15)/p+1.
What are the key properties of 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide?
3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide has a molecular weight of 255.75 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-chloro-2-methyl-1,3-benzothiazol-3-ium-3-yl)propanamide is sourced from PubChem (CID 20721795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).