C7H14N3+ — CID 20721796
3-ethyl-1,4,5-trimethyl-1,2,4-triazol-4-ium (PubChem CID 20721796) has the molecular formula C7H14N3+ and a molecular weight of 140.21 g/mol. Its IUPAC name is 3-ethyl-1,4,5-trimethyl-1,2,4-triazol-4-ium.
| Compound Name | 3-ethyl-1,4,5-trimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 20721796 |
| Molecular Formula | C7H14N3+ |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 3-ethyl-1,4,5-trimethyl-1,2,4-triazol-4-ium |
| SMILES | CCc1nn(C)c(C)[n+]1C |
| InChI | InChI=1S/C7H14N3/c1-5-7-8-10(4)6(2)9(7)3/h5H2,1-4H3/q+1 |
| InChIKey | KMLUXQSUAOZIMD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|