About 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate
2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate (PubChem CID 20721855) has the molecular formula C19H24O5
and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate.
Molecular Properties
| Compound Name | 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate |
| PubChem CID | 20721855 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate |
| SMILES | CCC(C)c1ccc(OC(C)OCCOC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H24O5/c1-4-14(2)16-7-9-17(10-8-16)24-15(3)21-12-13-23-19(20)18-6-5-11-22-18/h5-11,14-15H,4,12-13H2,1-3H3 |
| InChIKey | PNWOHWDLYCCUMG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate?
The IUPAC name of 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate (CID 20721855) is 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate.
What is the SMILES notation for 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate?
The canonical SMILES for 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate is CCC(C)c1ccc(OC(C)OCCOC(=O)c2ccco2)cc1.
What is the InChIKey of 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate?
The InChIKey is PNWOHWDLYCCUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O5/c1-4-14(2)16-7-9-17(10-8-16)24-15(3)21-12-13-23-19(20)18-6-5-11-22-18/h5-11,14-15H,4,12-13H2,1-3H3.
What are the key properties of 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate?
2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate has a molecular weight of 332.40 g/mol, XLogP of 4.39, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-butan-2-ylphenoxy)ethoxy]ethyl furan-2-carboxylate is sourced from PubChem (CID 20721855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).