C23H32O6 — CID 20722011
5-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethoxy]-1,2,3-trimethoxybenzene (PubChem CID 20722011) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 5-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethoxy]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethoxy]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 20722011 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 5-[2-[1-(4-butan-2-ylphenoxy)ethoxy]ethoxy]-1,2,3-trimethoxybenzene |
| SMILES | CCC(C)c1ccc(OC(C)OCCOc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H32O6/c1-7-16(2)18-8-10-19(11-9-18)29-17(3)27-12-13-28-20-14-21(24-4)23(26-6)22(15-20)25-5/h8-11,14-17H,7,12-13H2,1-6H3 |
| InChIKey | VQAKRNQHNSXZDS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|