C22H26N2O5S — CID 20722475
ethyl 2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate (PubChem CID 20722475) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is ethyl 2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate.
| Compound Name | ethyl 2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
|---|---|
| PubChem CID | 20722475 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl 2-[2-[3-(2,4-dimethylphenoxy)propyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
| SMILES | CCOC(=O)CC1=Nc2ccccc2S(=O)(=O)N1CCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C22H26N2O5S/c1-4-28-22(25)15-21-23-18-8-5-6-9-20(18)30(26,27)24(21)12-7-13-29-19-11-10-16(2)14-17(19)3/h5-6,8-11,14H,4,7,12-13,15H2,1-3H3 |
| InChIKey | POHQAEQEXCUJRF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|