C39H35N2O4+ — CID 20722754
methyl 1-[4-(1-methylpyridin-1-ium-3-yl)-4-oxobutyl]-5-trityloxyindole-2-carboxylate (PubChem CID 20722754) has the molecular formula C39H35N2O4+ and a molecular weight of 595.72 g/mol. Its IUPAC name is methyl 1-[4-(1-methylpyridin-1-ium-3-yl)-4-oxobutyl]-5-trityloxyindole-2-carboxylate.
| Compound Name | methyl 1-[4-(1-methylpyridin-1-ium-3-yl)-4-oxobutyl]-5-trityloxyindole-2-carboxylate |
|---|---|
| PubChem CID | 20722754 |
| Molecular Formula | C39H35N2O4+ |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | methyl 1-[4-(1-methylpyridin-1-ium-3-yl)-4-oxobutyl]-5-trityloxyindole-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(OC(c3ccccc3)(c3ccccc3)c3ccccc3)ccc2n1CCCC(=O)c1ccc[n+](C)c1 |
| InChI | InChI=1S/C39H35N2O4/c1-40-24-12-14-29(28-40)37(42)21-13-25-41-35-23-22-34(26-30(35)27-36(41)38(43)44-2)45-39(31-15-6-3-7-16-31,32-17-8-4-9-18-32)33-19-10-5-11-20-33/h3-12,14-20,22-24,26-28H,13,21,25H2,1-2H3/q+1 |
| InChIKey | SPWQZQQKKLZETL-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|