C25H27ClF6N2O2 — CID 20722827
(1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide;hydrochloride (PubChem CID 20722827) has the molecular formula C25H27ClF6N2O2 and a molecular weight of 536.94 g/mol. Its IUPAC name is (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide;hydrochloride.
| Compound Name | (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 20722827 |
| Molecular Formula | C25H27ClF6N2O2 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-azabicyclo[3.2.1]octane-6-carboxamide;hydrochloride |
| SMILES | CNC(=O)[C@H]1C[C@@]2(c3ccccc3)N[C@@H]1CC[C@@H]2OC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C25H26F6N2O2.ClH/c1-14(15-10-17(24(26,27)28)12-18(11-15)25(29,30)31)35-21-9-8-20-19(22(34)32-2)13-23(21,33-20)16-6-4-3-5-7-16;/h3-7,10-12,14,19-21,33H,8-9,13H2,1-2H3,(H,32,34);1H/t14?,19-,20+,21-,23-;/m0./s1 |
| InChIKey | GIKAQOFFAAJKJJ-ATNQFYLMSA-N |
| XLogP | 6.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |