C33H34F6N2O2 — CID 20722832
(1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-(1-phenylethyl)-8-azabicyclo[3.2.1]octane-6-carboxamide (PubChem CID 20722832) has the molecular formula C33H34F6N2O2 and a molecular weight of 604.64 g/mol. Its IUPAC name is (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-(1-phenylethyl)-8-azabicyclo[3.2.1]octane-6-carboxamide.
| Compound Name | (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-(1-phenylethyl)-8-azabicyclo[3.2.1]octane-6-carboxamide |
|---|---|
| PubChem CID | 20722832 |
| Molecular Formula | C33H34F6N2O2 |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | (1S,2S,5R,6S)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N-methyl-1-phenyl-8-(1-phenylethyl)-8-azabicyclo[3.2.1]octane-6-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@]2(c3ccccc3)[C@@H](OC(C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC[C@H]1N2C(C)c1ccccc1 |
| InChI | InChI=1S/C33H34F6N2O2/c1-20(22-10-6-4-7-11-22)41-28-14-15-29(31(41,19-27(28)30(42)40-3)24-12-8-5-9-13-24)43-21(2)23-16-25(32(34,35)36)18-26(17-23)33(37,38)39/h4-13,16-18,20-21,27-29H,14-15,19H2,1-3H3,(H,40,42)/t20?,21?,27-,28+,29-,31-/m0/s1 |
| InChIKey | AEYBJRJRFZSFFR-NNANFJTDSA-N |
| XLogP | 8.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |