About [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten
[(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten (PubChem CID 20723076) has the molecular formula C8H11W-
and a molecular weight of 291.02 g/mol. Its IUPAC name is [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten.
Molecular Properties
| Compound Name | [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten |
| PubChem CID | 20723076 |
| Molecular Formula | C8H11W- |
| Molecular Weight | 291.02 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten |
| SMILES | [H]/[C-]=C(C)/C=C(/C)C(C)=[W] |
| InChI | InChI=1S/C8H11.W/c1-5-8(4)6-7(2)3;/h2,6H,1,3-4H3;/q-1;/b8-6-; |
| InChIKey | HXBCAZOEVNDSTA-PHZXCRFESA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.02 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten?
The IUPAC name of [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten (CID 20723076) is [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten.
What is the SMILES notation for [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten?
The canonical SMILES for [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten is [H]/[C-]=C(C)/C=C(/C)C(C)=[W].
What is the InChIKey of [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten?
The InChIKey is HXBCAZOEVNDSTA-PHZXCRFESA-N. The full InChI is InChI=1S/C8H11.W/c1-5-8(4)6-7(2)3;/h2,6H,1,3-4H3;/q-1;/b8-6-;.
What are the key properties of [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten?
[(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten has a molecular weight of 291.02 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-3,5-dimethylhexa-3,5-dien-2-ylidene]tungsten is sourced from PubChem (CID 20723076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).