C19H18N2O7 — CID 20723773
methyl 6-[1,3,5,7-tetraoxo-2-(2-oxoethyl)pyrrolo[3,4-f]isoindol-6-yl]hexanoate (PubChem CID 20723773) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is methyl 6-[1,3,5,7-tetraoxo-2-(2-oxoethyl)pyrrolo[3,4-f]isoindol-6-yl]hexanoate.
| Compound Name | methyl 6-[1,3,5,7-tetraoxo-2-(2-oxoethyl)pyrrolo[3,4-f]isoindol-6-yl]hexanoate |
|---|---|
| PubChem CID | 20723773 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl 6-[1,3,5,7-tetraoxo-2-(2-oxoethyl)pyrrolo[3,4-f]isoindol-6-yl]hexanoate |
| SMILES | COC(=O)CCCCCn1c(=O)c2cc3c(=O)n(CC=O)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C19H18N2O7/c1-28-15(23)5-3-2-4-6-20-16(24)11-9-13-14(10-12(11)17(20)25)19(27)21(7-8-22)18(13)26/h8-10H,2-7H2,1H3 |
| InChIKey | IWZIMFDNRMICLH-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 121.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|