About 3-phenylbutanoic acid
3-phenylbutanoic acid (PubChem CID 20724) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-phenylbutanoic acid.
Molecular Properties
| Compound Name | 3-phenylbutanoic acid |
| PubChem CID | 20724 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-phenylbutanoic acid |
| SMILES | CC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| InChIKey | ZZEWMYILWXCRHZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylbutanoic acid?
The IUPAC name of 3-phenylbutanoic acid (CID 20724) is 3-phenylbutanoic acid.
What is the SMILES notation for 3-phenylbutanoic acid?
The canonical SMILES for 3-phenylbutanoic acid is CC(CC(=O)O)c1ccccc1.
What is the InChIKey of 3-phenylbutanoic acid?
The InChIKey is ZZEWMYILWXCRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12).
What are the key properties of 3-phenylbutanoic acid?
3-phenylbutanoic acid has a molecular weight of 164.20 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylbutanoic acid is sourced from PubChem (CID 20724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).