C96H86 — CID 20724612
9,10-bis[4-[(E)-2-[9-butyl-9-(4-tert-butylphenyl)fluoren-2-yl]-1-phenylethenyl]phenyl]anthracene (PubChem CID 20724612) has the molecular formula C96H86 and a molecular weight of 1239.74 g/mol. Its IUPAC name is 9,10-bis[4-[(E)-2-[9-butyl-9-(4-tert-butylphenyl)fluoren-2-yl]-1-phenylethenyl]phenyl]anthracene.
| Compound Name | 9,10-bis[4-[(E)-2-[9-butyl-9-(4-tert-butylphenyl)fluoren-2-yl]-1-phenylethenyl]phenyl]anthracene |
|---|---|
| PubChem CID | 20724612 |
| Molecular Formula | C96H86 |
| Molecular Weight | 1239.74 g/mol |
| Exact Mass | 1238.67 |
| IUPAC Name | 9,10-bis[4-[(E)-2-[9-butyl-9-(4-tert-butylphenyl)fluoren-2-yl]-1-phenylethenyl]phenyl]anthracene |
| SMILES | CCCCC1(c2ccc(C(C)(C)C)cc2)c2ccccc2-c2ccc(/C=C(\c3ccccc3)c3ccc(-c4c5ccccc5c(-c5ccc(/C(=C/c6ccc7c(c6)C(CCCC)(c6ccc(C(C)(C)C)cc6)c6ccccc6-7)c6ccccc6)cc5)c5ccccc45)cc3)cc21 |
| InChI | InChI=1S/C96H86/c1-9-11-59-95(75-53-49-73(50-54-75)93(3,4)5)87-37-25-23-31-77(87)79-57-39-65(63-89(79)95)61-85(67-27-15-13-16-28-67)69-41-45-71(46-42-69)91-81-33-19-21-35-83(81)92(84-36-22-20-34-82(84)91)72-47-43-70(44-48-72)86(68-29-17-14-18-30-68)62-66-40-58-80-78-32-24-26-38-88(78)96(60-12-10-2,90(80)64-66)76-55-51-74(52-56-76)94(6,7)8/h13-58,61-64H,9-12,59-60H2,1-8H3/b85-61+,86-62+ |
| InChIKey | NZKMLQRAOIWRRC-ZOPCCVKFSA-N |
| XLogP | 26.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1239.74 |
| LogP ≤ 5 | 26.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|