About 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate
1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 20724641) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 20724641 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CCOC(C)OC(=O)C1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C14H26O3/c1-5-16-11(4)17-14(15)13-8-6-12(7-9-13)10(2)3/h10-13H,5-9H2,1-4H3 |
| InChIKey | PDSFGUHBTPJEEI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate (CID 20724641) is 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate is CCOC(C)OC(=O)C1CCC(C(C)C)CC1.
What is the InChIKey of 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is PDSFGUHBTPJEEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-5-16-11(4)17-14(15)13-8-6-12(7-9-13)10(2)3/h10-13H,5-9H2,1-4H3.
What are the key properties of 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate?
1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 242.36 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethyl 4-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 20724641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).