About 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate
1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 20724642) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate |
| PubChem CID | 20724642 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | CCOC(CC)OC(=O)C1CCC(C(C)C)CC1CC |
| InChI | InChI=1S/C17H32O3/c1-6-13-11-14(12(4)5)9-10-15(13)17(18)20-16(7-2)19-8-3/h12-16H,6-11H2,1-5H3 |
| InChIKey | HPUVRSCSXTYDJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The IUPAC name of 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate (CID 20724642) is 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate.
What is the SMILES notation for 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The canonical SMILES for 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate is CCOC(CC)OC(=O)C1CCC(C(C)C)CC1CC.
What is the InChIKey of 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate?
The InChIKey is HPUVRSCSXTYDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-6-13-11-14(12(4)5)9-10-15(13)17(18)20-16(7-2)19-8-3/h12-16H,6-11H2,1-5H3.
What are the key properties of 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate?
1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate has a molecular weight of 284.44 g/mol, XLogP of 4.40, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropyl 2-ethyl-4-propan-2-ylcyclohexane-1-carboxylate is sourced from PubChem (CID 20724642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).