C19H19FN2O4 — CID 20724744
benzyl 2-[2-(4-fluorophenyl)acetyl]-4-hydroxypyrazolidine-1-carboxylate (PubChem CID 20724744) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is benzyl 2-[2-(4-fluorophenyl)acetyl]-4-hydroxypyrazolidine-1-carboxylate.
| Compound Name | benzyl 2-[2-(4-fluorophenyl)acetyl]-4-hydroxypyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 20724744 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | benzyl 2-[2-(4-fluorophenyl)acetyl]-4-hydroxypyrazolidine-1-carboxylate |
| SMILES | O=C(Cc1ccc(F)cc1)N1CC(O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19FN2O4/c20-16-8-6-14(7-9-16)10-18(24)21-11-17(23)12-22(21)19(25)26-13-15-4-2-1-3-5-15/h1-9,17,23H,10-13H2 |
| InChIKey | ZUTIOUJGTRXZOF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |