About 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol
3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol (PubChem CID 20725090) has the molecular formula C23H50O5Si2
and a molecular weight of 462.82 g/mol. Its IUPAC name is 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol |
| PubChem CID | 20725090 |
| Molecular Formula | C23H50O5Si2 |
| Molecular Weight | 462.82 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol |
| SMILES | CCCCCCCCCC/[Si](=C/O[Si](C)(C)C)OCC(C)CCCOCC(O)CO |
| InChI | InChI=1S/C23H50O5Si2/c1-6-7-8-9-10-11-12-13-17-29(21-28-30(3,4)5)27-19-22(2)15-14-16-26-20-23(25)18-24/h21-25H,6-20H2,1-5H3/b29-21- |
| InChIKey | JQDUVYADMBRNAG-ANYBSYGZSA-N |
| XLogP | 5.11 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.82 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol?
The IUPAC name of 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol (CID 20725090) is 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol.
What is the SMILES notation for 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol?
The canonical SMILES for 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol is CCCCCCCCCC/[Si](=C/O[Si](C)(C)C)OCC(C)CCCOCC(O)CO.
What is the InChIKey of 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol?
The InChIKey is JQDUVYADMBRNAG-ANYBSYGZSA-N. The full InChI is InChI=1S/C23H50O5Si2/c1-6-7-8-9-10-11-12-13-17-29(21-28-30(3,4)5)27-19-22(2)15-14-16-26-20-23(25)18-24/h21-25H,6-20H2,1-5H3/b29-21-.
What are the key properties of 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol?
3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol has a molecular weight of 462.82 g/mol, XLogP of 5.11, 21 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(Z)-decyl(trimethylsilyloxymethylidene)silyl]oxy-4-methylpentoxy]propane-1,2-diol is sourced from PubChem (CID 20725090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).