C12H23NSi — CID 20725131
N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]methanamine (PubChem CID 20725131) has the molecular formula C12H23NSi and a molecular weight of 209.41 g/mol. Its IUPAC name is N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]methanamine.
| Compound Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]methanamine |
|---|---|
| PubChem CID | 20725131 |
| Molecular Formula | C12H23NSi |
| Molecular Weight | 209.41 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-[dimethyl-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silyl]methanamine |
| SMILES | CN[Si](C)(C)C1=C(C)C(C)=C(C)C1C |
| InChI | InChI=1S/C12H23NSi/c1-8-9(2)11(4)12(10(8)3)14(6,7)13-5/h10,13H,1-7H3 |
| InChIKey | UEJIQFBWVPWYOU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|