C16H34N+ — CID 20725286
3-(2,4-dimethylhexyl)-1,1,5-trimethylpiperidin-1-ium (PubChem CID 20725286) has the molecular formula C16H34N+ and a molecular weight of 240.45 g/mol. Its IUPAC name is 3-(2,4-dimethylhexyl)-1,1,5-trimethylpiperidin-1-ium.
| Compound Name | 3-(2,4-dimethylhexyl)-1,1,5-trimethylpiperidin-1-ium |
|---|---|
| PubChem CID | 20725286 |
| Molecular Formula | C16H34N+ |
| Molecular Weight | 240.45 g/mol |
| Exact Mass | 240.27 |
| IUPAC Name | 3-(2,4-dimethylhexyl)-1,1,5-trimethylpiperidin-1-ium |
| SMILES | CCC(C)CC(C)CC1CC(C)C[N+](C)(C)C1 |
| InChI | InChI=1S/C16H34N/c1-7-13(2)8-14(3)9-16-10-15(4)11-17(5,6)12-16/h13-16H,7-12H2,1-6H3/q+1 |
| InChIKey | IMYOHHGALCVWGU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|