C7H8F6O — CID 20725476
5-ethyl-2,2,3,3,5-pentafluoro-4-(fluoromethyl)oxolane (PubChem CID 20725476) has the molecular formula C7H8F6O and a molecular weight of 222.13 g/mol. Its IUPAC name is 5-ethyl-2,2,3,3,5-pentafluoro-4-(fluoromethyl)oxolane.
| Compound Name | 5-ethyl-2,2,3,3,5-pentafluoro-4-(fluoromethyl)oxolane |
|---|---|
| PubChem CID | 20725476 |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 5-ethyl-2,2,3,3,5-pentafluoro-4-(fluoromethyl)oxolane |
| SMILES | CCC1(F)OC(F)(F)C(F)(F)C1CF |
| InChI | InChI=1S/C7H8F6O/c1-2-5(9)4(3-8)6(10,11)7(12,13)14-5/h4H,2-3H2,1H3 |
| InChIKey | NXQQUCBNGGUKAR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|